EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:203879 - 2R-amino-4S-hydroxy-5-hexynoic acid
| Formula | C6H9NO3 |
| Net Charge | 0 |
| Average Mass | 143.142 |
| Monoisotopic Mass | 143.05824 |
| SMILES | C#C[C@@H](O)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H9NO3/c1-2-4(8)3-5(7)6(9)10/h1,4-5,8H,3,7H2,(H,9,10)/t4-,5-/m1/s1 |
| InChIKey | HHGQBMHJPJMZRN-RFZPGFLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lasiodiplodiaspecies (ncbitaxon:1891967) | - | PubMed (22287497) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2R-amino-4S-hydroxy-5-hexynoic acid (CHEBI:203879) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (2R,4S)-2-amino-4-hydroxyhex-5-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28289723 | ChemSpider |