EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46ClN4O10P |
| Net Charge | 0 |
| Average Mass | 761.209 |
| Monoisotopic Mass | 760.26401 |
| SMILES | CO[C@@H]1C(=O)O[C@H](C)[C@@H](C)/C=C(/C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2c(Cl)nc3ccccc23)C(=O)NC1c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C36H46ClN4O10P/c1-19-16-20(2)23(5)50-36(45)31(49-7)30(24-12-14-25(15-13-24)51-52(46,47)48)40-34(43)29(18-27-26-10-8-9-11-28(26)39-32(27)37)41(6)35(44)22(4)38-33(42)21(3)17-19/h8-16,20-23,29-31,39H,17-18H2,1-7H3,(H,38,42)(H,40,43)(H2,46,47,48)/b19-16-/t20-,21-,22-,23+,29+,30?,31-/m0/s1 |
| InChIKey | MMDULLAOZKKTLT-IWAAHAGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces (ncbitaxon:50) | - | PubMed (23959765) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chrondramide 9 (CHEBI:203872) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [4-[(3S,7R,10S,13S,15Z,17S,18R)-7-[(2-chloro-1H-indol-3-yl)methyl]-3-methoxy-8,10,13,15,17,18-hexamethyl-2,6,9,12-tetraoxo-1-oxa-5,8,11-triazacyclooctadec-15-en-4-yl]phenyl] dihydrogen phosphate |
| Manual Xrefs | Databases |
|---|---|
| 78442580 | ChemSpider |