EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H58N2O10 |
| Net Charge | 0 |
| Average Mass | 774.952 |
| Monoisotopic Mass | 774.40915 |
| SMILES | C/C=C/C(O)C(C)(C)C1C/C=C\C=C/C=CC(OC)Cc2nc(co2)C(=O)OC(C(C)(C)C(O)/C=C/C)C/C=C\C(OC)/C=C\C=C/Cc2nc(co2)C(=O)O1 |
| InChI | InChI=1S/C44H58N2O10/c1-9-20-35(47)43(3,4)37-25-17-13-11-12-15-23-32(52-8)28-40-46-34(30-54-40)42(50)56-38(44(5,6)36(48)21-10-2)26-19-24-31(51-7)22-16-14-18-27-39-45-33(29-53-39)41(49)55-37/h9-24,29-32,35-38,47-48H,25-28H2,1-8H3/b12-11-,17-13-,18-14-,20-9+,21-10+,22-16-,23-15?,24-19- |
| InChIKey | TYQJSUQHTRMHHX-PWJNQAGBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium (ncbitaxon:39643) | - | DOI (10.1002/jlac.199419940802) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disorazole-C2 (CHEBI:203860) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (6Z,8Z,22Z,25Z,27Z)-4,20-bis[(E)-3-hydroxy-2-methylhex-4-en-2-yl]-12,24-dimethoxy-3,15,19,31-tetraoxa-33,34-diazatricyclo[28.2.1.114,17]tetratriaconta-1(32),6,8,10,14(34),16,22,25,27,30(33)-decaene-2,18-dione |