EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO5 |
| Net Charge | 0 |
| Average Mass | 177.156 |
| Monoisotopic Mass | 177.06372 |
| SMILES | C[C@](O)(C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO5/c1-6(12,5(10)11)2-3(7)4(8)9/h3,12H,2,7H2,1H3,(H,8,9)(H,10,11)/t3-,6-/m0/s1 |
| InChIKey | ONTAOGAXMOTXQW-DZSWIPIPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S)-4-hydroxy-4-methyl-L-glutamic acid (CHEBI:20384) is a 4-hydroxy-4-methyl-L-glutamic acid (CHEBI:194201) |
| (4S)-4-hydroxy-4-methyl-L-glutamic acid (CHEBI:20384) is conjugate acid of (2S,4S)-4-hydroxy-4-methylglutamate(1−) (CHEBI:167901) |
| Incoming Relation(s) |
| (2S,4S)-4-hydroxy-4-methylglutamate(1−) (CHEBI:167901) is conjugate base of (4S)-4-hydroxy-4-methyl-L-glutamic acid (CHEBI:20384) |
| IUPAC Name |
|---|
| (2S,4S)-4-amino-2-hydroxy-2-methylpentanedioic acid |
| Synonym | Source |
|---|---|
| (2S,4S)-4-hydroxy-4-methylglutamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06034 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2364270 | Reaxys |