EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N4O4 |
| Net Charge | 0 |
| Average Mass | 454.571 |
| Monoisotopic Mass | 454.25801 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C25H34N4O4/c1-16(2)14-18-24(32)28-12-6-11-21(28)23(31)27-19(15-17-8-4-3-5-9-17)25(33)29-13-7-10-20(29)22(30)26-18/h3-5,8-9,16,18-21H,6-7,10-15H2,1-2H3,(H,26,30)(H,27,31)/t18-,19-,20-,21-/m0/s1 |
| InChIKey | DGVAQUZMNFTFKE-TUFLPTIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonasspecies (ncbitaxon:306) | - | DOI (10.1016/j.tet.2008.01.089) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo-[phenylalanyl-prolyl-leucyl-prolyl] (CHEBI:203815) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6S,12S,15S)-3-benzyl-12-(2-methylpropyl)-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 27023277 | ChemSpider |