EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O9 |
| Net Charge | 0 |
| Average Mass | 372.285 |
| Monoisotopic Mass | 372.04813 |
| SMILES | Cc1cc(O)c(C(=O)O)c2c1C(=O)Oc1c(C)c(O)c3c(c1O2)COC3=O |
| InChI | InChI=1S/C18H12O9/c1-5-3-8(19)11(16(21)22)15-9(5)18(24)27-13-6(2)12(20)10-7(14(13)26-15)4-25-17(10)23/h3,19-20H,4H2,1-2H3,(H,21,22) |
| InChIKey | MVANNUHXKUVXCX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaeographis (ncbitaxon:297881) | - | DOI (10.1071/ch02194) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neotricone (CHEBI:203812) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| 5,13-dihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435452 | ChemSpider |