EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35NO2 |
| Net Charge | 0 |
| Average Mass | 369.549 |
| Monoisotopic Mass | 369.26678 |
| SMILES | CC1=C[C@@H]2/C=C(/C)CCCC/C=C\C(=O)[C@]23C(=O)N[C@@H](CC(C)C)[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C24H35NO2/c1-15(2)12-20-22-18(5)17(4)14-19-13-16(3)10-8-6-7-9-11-21(26)24(19,22)23(27)25-20/h9,11,13-15,18-20,22H,6-8,10,12H2,1-5H3,(H,25,27)/b11-9-,16-13-/t18-,19+,20+,22+,24-/m1/s1 |
| InChIKey | ZRIHKTRPGQFSOY-VXGFLCMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niveus (ncbitaxon:41281) | - | PubMed (15712664) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspochalasin Z (CHEBI:203803) has role fungal metabolite (CHEBI:76946) |
| Aspochalasin Z (CHEBI:203803) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| (1S,3Z,9Z,11S,14S,15R,16S)-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-triene-2,18-dione |
| Manual Xrefs | Databases |
|---|---|
| 78440969 | ChemSpider |