EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O3 |
| Net Charge | 0 |
| Average Mass | 314.385 |
| Monoisotopic Mass | 314.16304 |
| SMILES | CC/C(C)=C/CC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H22N2O3/c1-3-12(2)8-9-17(21)20-16(18(22)23)10-13-11-19-15-7-5-4-6-14(13)15/h4-8,11,16,19H,3,9-10H2,1-2H3,(H,20,21)(H,22,23)/b12-8+/t16-/m0/s1 |
| InChIKey | ATGGIXUEYOJHSA-RCLKMUNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1002/hlca.201100104) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptomycindole (CHEBI:203798) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-[[(E)-4-methylhex-3-enoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28185064 | ChemSpider |