EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H54N6O8 |
| Net Charge | 0 |
| Average Mass | 758.917 |
| Monoisotopic Mass | 758.40031 |
| SMILES | CC(C)=CCN=C(N)NCCC[C@@H](NC(=O)CCCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C41H54N6O8/c1-27(2)21-23-44-41(42)43-22-7-11-33(45-37(51)12-6-10-28-13-17-31(48)18-14-28)39(53)47-34(24-29-8-4-3-5-9-29)36(50)26-38(52)46-35(40(54)55)25-30-15-19-32(49)20-16-30/h3-5,8-9,13-21,33-36,48-50H,6-7,10-12,22-26H2,1-2H3,(H,45,51)(H,46,52)(H,47,53)(H,54,55)(H3,42,43,44)/t33-,34+,35+,36+/m1/s1 |
| InChIKey | QNUNSWNHYZFQQQ-WISKXVKBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stictaspecies (ncbitaxon:2012247) | - | PubMed (21500817) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stictamide A (CHEBI:203787) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3S,4S)-3-hydroxy-4-[[(2R)-2-[4-(4-hydroxyphenyl)butanoylamino]-5-[[N'-(3-methylbut-2-enyl)carbamimidoyl]amino]pentanoyl]amino]-5-phenylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 25948196 | ChemSpider |