EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | CCC(O)CC(=O)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-2-4(7)3-5(8)6(9)10/h4,7H,2-3H2,1H3,(H,9,10) |
| InChIKey | ALFQPWXBAWHVDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) has functional parent hexanoic acid (CHEBI:30776) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) is a hydroxy fatty acid (CHEBI:24654) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) is a oxo fatty acid (CHEBI:59644) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) is conjugate acid of 4-hydroxy-2-oxohexanoate (CHEBI:53800) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxohexanoic acid (CHEBI:73151) is a 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is conjugate base of 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) |
| IUPAC Name |
|---|
| 4-hydroxy-2-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-2-oxohexanoic acid | KEGG COMPOUND |
| 2-Oxo-4-hydroxycapronsäure | ChEBI |
| 4-hydroxy-2-oxocaproic acid | ChEBI |
| 4-Hydroxy-2-oxohexanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06762 | KEGG COMPOUND |
| LMFA01050343 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2637006 | Reaxys |