EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O3S2 |
| Net Charge | 0 |
| Average Mass | 324.427 |
| Monoisotopic Mass | 324.06023 |
| SMILES | CN1C(=O)[C@@]2(Cc3ccccc3)SS[C@]1(CO)C(=O)N2C |
| InChI | InChI=1S/C14H16N2O3S2/c1-15-12(19)14(9-17)16(2)11(18)13(15,20-21-14)8-10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | SJRIMIDQFZMJPZ-ZIAGYGMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium turbatum (ncbitaxon:70105) | - | PubMed (4367201) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A26771A (CHEBI:203748) is a 2,5-diketopiperazines (CHEBI:65061) |
| A26771A (CHEBI:203748) is a indoles (CHEBI:24828) |
| A26771A (CHEBI:203748) is a organic disulfide (CHEBI:35489) |
| A26771A (CHEBI:203748) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,4R)-1-benzyl-4-(hydroxymethyl)-5,7-dimethyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione |
| Manual Xrefs | Databases |
|---|---|
| 78437052 | ChemSpider |