EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H51N7O7 |
| Net Charge | 0 |
| Average Mass | 705.857 |
| Monoisotopic Mass | 705.38500 |
| SMILES | CC(O)CC/C=C/CCC/C=C/C=C/C(=O)N/C=C/C(=O)NCC1NC(=O)[C@H](Cc2ccccc2)NC(=O)CN2C(=O)C(CNC1=O)NC2(C)C |
| InChI | InChI=1S/C37H51N7O7/c1-26(45)16-12-9-7-5-4-6-8-10-15-19-31(46)38-21-20-32(47)39-23-29-34(49)40-24-30-36(51)44(37(2,3)43-30)25-33(48)41-28(35(50)42-29)22-27-17-13-11-14-18-27/h7-11,13-15,17-21,26,28-30,43,45H,4-6,12,16,22-25H2,1-3H3,(H,38,46)(H,39,47)(H,40,49)(H,41,48)(H,42,50)/b9-7+,10-8+,19-15+,21-20+/t26?,28-,29?,30?/m0/s1 |
| InChIKey | HEQUMWPCRPDUAA-WTKBPMQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7706133) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enamidonin (CHEBI:203697) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2E,4E,9E)-N-[(E)-3-[[(5S)-5-benzyl-14,14-dimethyl-3,6,9,15-tetraoxo-1,4,7,10,13-pentazabicyclo[10.2.1]pentadecan-8-yl]methylamino]-3-oxoprop-1-enyl]-13-hydroxytetradeca-2,4,9-trienamide |
| Manual Xrefs | Databases |
|---|---|
| 8660331 | ChemSpider |