EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:20364 - 4-fluorobenzoic acid
| Formula | C7H5FO2 |
| Net Charge | 0 |
| Average Mass | 140.113 |
| Monoisotopic Mass | 140.02736 |
| SMILES | O=C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C7H5FO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | BBYDXOIZLAWGSL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fluorobenzoic acid (CHEBI:20364) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 4-fluorobenzoic acid (CHEBI:20364) is a fluorobenzoic acid (CHEBI:24071) |
| 4-fluorobenzoic acid (CHEBI:20364) is conjugate acid of 4-fluorobenzoate (CHEBI:27893) |
| Incoming Relation(s) |
| 4-fluorobenzoyl-CoA (CHEBI:27677) has functional parent 4-fluorobenzoic acid (CHEBI:20364) |
| 4-fluorobenzoate (CHEBI:27893) is conjugate base of 4-fluorobenzoic acid (CHEBI:20364) |
| IUPAC Name |
|---|
| 4-fluorobenzoic acid |
| Synonyms | Source |
|---|---|
| 4-Fluorobenzoic acid | KEGG COMPOUND |
| p-fluorobenzoic acid | ChemIDplus |
| para-fluorobenzoic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C02371 | KEGG COMPOUND |
| 4-Fluorobenzoic_acid | Wikipedia |
| Citations |
|---|