EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H65N7O9 |
| Net Charge | 0 |
| Average Mass | 812.022 |
| Monoisotopic Mass | 811.48438 |
| SMILES | CCCC(=O)N[C@H](C(=O)N[C@@H]1C(=O)N[C@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)O[C@@H]1C)C(C)C |
| InChI | InChI=1S/C42H65N7O9/c1-11-16-30(50)44-31(22(2)3)37(52)48-35-26(10)58-42(57)34(25(8)9)47-39(54)33(24(6)7)46-38(53)32(23(4)5)45-36(51)29-19-15-20-49(29)41(56)28(43-40(35)55)21-27-17-13-12-14-18-27/h12-14,17-18,22-26,28-29,31-35H,11,15-16,19-21H2,1-10H3,(H,43,55)(H,44,50)(H,45,51)(H,46,53)(H,47,54)(H,48,52)/t26-,28-,29+,31+,32+,33+,34+,35+/m1/s1 |
| InChIKey | ITHVGOYCXWIZMQ-DJFTVNPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (23025386) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xentrivalpeptide D (CHEBI:203598) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (2S)-N-[(3R,6S,7R,10S,13S,16S,19S)-3-benzyl-7-methyl-2,5,9,12,15,18-hexaoxo-10,13,16-tri(propan-2-yl)-8-oxa-1,4,11,14,17-pentazabicyclo[17.3.0]docosan-6-yl]-2-(butanoylamino)-3-methylbutanamide |
| Manual Xrefs | Databases |
|---|---|
| 78440166 | ChemSpider |