EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8ClNO2 |
| Net Charge | 0 |
| Average Mass | 149.577 |
| Monoisotopic Mass | 149.02436 |
| SMILES | N[C@@H](C/C=C\Cl)C(=O)O |
| InChI | InChI=1S/C5H8ClNO2/c6-3-1-2-4(7)5(8)9/h1,3-4H,2,7H2,(H,8,9)/b3-1-/t4-/m0/s1 |
| InChIKey | QAHGWXYRQRKWSN-HNHRSYQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amanita (ncbitaxon:41955) | - | DOI (10.1248/cpb.43.899) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-cis-2-Amino-5-chloro-4-pentenoic acid (CHEBI:203558) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (Z,2S)-2-amino-5-chloropent-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8504891 | ChemSpider |