EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CC1(C)O[C@@](C)(c2ccc(C(=O)O)cc2O)CC[C@@H]1O |
| InChI | InChI=1S/C15H20O5/c1-14(2)12(17)6-7-15(3,20-14)10-5-4-9(13(18)19)8-11(10)16/h4-5,8,12,16-17H,6-7H2,1-3H3,(H,18,19)/t12-,15+/m0/s1 |
| InChIKey | NJYYNDIOQUHINB-SWLSCSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25879502) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-(7R,10S)-10-hydroxysydowic acid (CHEBI:203528) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3-hydroxy-4-[(2R,5S)-5-hydroxy-2,6,6-trimethyloxan-2-yl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440950 | ChemSpider |