EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO5 |
| Net Charge | 0 |
| Average Mass | 389.492 |
| Monoisotopic Mass | 389.22022 |
| SMILES | C/C=C/[C@@H]1C=C[C@@H]2C[C@@](C)(O)CC[C@H]2[C@]1(C)C(O)=C1C(=O)[C@H](CO)N(C)C1=O |
| InChI | InChI=1S/C22H31NO5/c1-5-6-14-8-7-13-11-21(2,28)10-9-15(13)22(14,3)19(26)17-18(25)16(12-24)23(4)20(17)27/h5-8,13-16,24,26,28H,9-12H2,1-4H3/b6-5+,19-17?/t13-,14-,15-,16+,21+,22-/m1/s1 |
| InChIKey | UBMMPGHGWNFULV-JVTHKHLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium incarnatum (ncbitaxon:298378) | - | PubMed (24422636) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pallidorosetin A (CHEBI:203444) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| (5S)-3-[[(1S,2R,4aS,6S,8aR)-6-hydroxy-1,6-dimethyl-2-[(E)-prop-1-enyl]-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]-hydroxymethylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78440161 | ChemSpider |