EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H38O16 |
| Net Charge | 0 |
| Average Mass | 918.860 |
| Monoisotopic Mass | 918.21599 |
| SMILES | CC(=O)Cc1cc2c(c(O)c1C(=O)O)-c1cc3c(c(O)c1CC2)C(=O)c1c(O)cc(O)cc1[C@H]3[C@H]1c2cc(O)cc(O)c2C(=O)c2c1cc1c(c2O)CCc2cc(CC(C)=O)c(C(=O)O)c(O)c2-1 |
| InChI | InChI=1S/C52H38O16/c1-17(53)7-21-9-19-3-5-25-27(35(19)47(61)37(21)51(65)66)15-31-39(29-11-23(55)13-33(57)41(29)49(63)43(31)45(25)59)40-30-12-24(56)14-34(58)42(30)50(64)44-32(40)16-28-26(46(44)60)6-4-20-10-22(8-18(2)54)38(52(67)68)48(62)36(20)28/h9-16,39-40,55-62H,3-8H2,1-2H3,(H,65,66)(H,67,68)/t39-,40+ |
| InChIKey | HTSWORYRFFMQSU-LQDDJWCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CN48 (ncbitaxon:1049553) | - | PubMed (24786728) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Griseorhodin D1/D2 (CHEBI:203423) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (13R)-13-[(13S)-2-carboxy-1,7,9,11-tetrahydroxy-8-oxo-3-(2-oxopropyl)-6,13-dihydro-5H-benzo[a]tetracen-13-yl]-1,7,9,11-tetrahydroxy-8-oxo-3-(2-oxopropyl)-6,13-dihydro-5H-benzo[a]tetracene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 58135633 | ChemSpider |