EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | C=C(CC[C@H](C(=O)O)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3)C(C)C |
| InChI | InChI=1S/C30H48O3/c1-18(2)19(3)8-9-21(27(32)33)23-12-11-22-20-10-13-25-28(4,5)26(31)15-17-30(25,7)24(20)14-16-29(22,23)6/h18,21-23,25-26,31H,3,8-17H2,1-2,4-7H3,(H,32,33)/t21-,22-,23+,25-,26-,29-,30+/m0/s1 |
| InChIKey | XKDQIZLYDBYWGU-KEKRBBGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gloeophyllum abietinum (ncbitaxon:180171) | - | PubMed (25915800) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gloeophyllin F (CHEBI:203421) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2S)-2-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |