EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24N2O8S4 |
| Net Charge | 0 |
| Average Mass | 632.763 |
| Monoisotopic Mass | 632.04155 |
| SMILES | COc1ccc(C(=O)O[C@H]2C=COC=C3C[C@]45SSSS[C@](Cc6ccc(O)cc6)(C(=O)N4[C@@H]32)N(C)C5=O)cc1O |
| InChI | InChI=1S/C27H24N2O8S4/c1-28-24(33)27-13-17-14-36-10-9-21(37-23(32)16-5-8-20(35-2)19(31)11-16)22(17)29(27)25(34)26(28,38-40-41-39-27)12-15-3-6-18(30)7-4-15/h3-11,14,21-22,30-31H,12-13H2,1-2H3/t21-,22-,26+,27+/m0/s1 |
| InChIKey | ONXASDRNDFVLMR-DOQQYFFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (24251417) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Secoemestrin D (CHEBI:203415) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(1R,8S,9S,12R)-12-[(4-hydroxyphenyl)methyl]-18-methyl-11,17-dioxo-5-oxa-13,14,15,16-tetrathia-10,18-diazatetracyclo[10.4.2.01,10.03,9]octadeca-3,6-dien-8-yl] 3-hydroxy-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 31130300 | ChemSpider |