EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O5 |
| Net Charge | 0 |
| Average Mass | 170.120 |
| Monoisotopic Mass | 170.02152 |
| SMILES | O=C(O)/C=C\C(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H6O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H,(H,9,10)(H,11,12)/b3-1-,4-2- |
| InChIKey | FORGRSMNOFWNBO-CCAGOZQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coprinus (ncbitaxon:5345) | - | PubMed (17393652) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Z,Z)-4-oxo-2,5-hetpadienedioic acid (CHEBI:203412) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (2Z,5Z)-4-oxohepta-2,5-dienedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434762 | ChemSpider |