EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8ClNO2 |
| Net Charge | 0 |
| Average Mass | 209.632 |
| Monoisotopic Mass | 209.02436 |
| SMILES | O=C(O)Cc1cnc2cccc(Cl)c12 |
| InChI | InChI=1S/C10H8ClNO2/c11-7-2-1-3-8-10(7)6(5-12-8)4-9(13)14/h1-3,5,12H,4H2,(H,13,14) |
| InChIKey | WNCFBCKZRJDRKZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | auxin Any of a group of compounds, both naturally occurring and synthetic, that induce cell elongation in plant stems (from Greek αυξανω, "to grow"). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloroindole-3-acetic acid (CHEBI:20339) has role auxin (CHEBI:22676) |
| 4-chloroindole-3-acetic acid (CHEBI:20339) is a chloroindole-3-acetic acid (CHEBI:37843) |
| IUPAC Name |
|---|
| (4-chloro-1H-indol-3-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 4-chloro-1H-indole-3-acetic acid | ChemIDplus |
| 4-chloroindole-3-acetic acid | ChemIDplus |
| 4-chloroindolyl-3-acetic acid | ChEBI |
| 4-Cl-IAA | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:170659 | Beilstein |
| CAS:2519-61-1 | ChemIDplus |