EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43N5O10 |
| Net Charge | 0 |
| Average Mass | 693.754 |
| Monoisotopic Mass | 693.30099 |
| SMILES | N[C@@H](CCCCNC(=O)c1cccc(O)c1O)C(=O)N[C@@H](CCCCNC(=O)c1cccc(O)c1O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C35H43N5O10/c36-24(14-4-6-18-37-31(45)22-12-8-16-27(41)29(22)43)33(47)39-25(34(48)40-26(35(49)50)20-21-10-2-1-3-11-21)15-5-7-19-38-32(46)23-13-9-17-28(42)30(23)44/h1-3,8-13,16-17,24-26,41-44H,4-7,14-15,18-20,36H2,(H,37,45)(H,38,46)(H,39,47)(H,40,48)(H,49,50)/t24-,25-,26-/m0/s1 |
| InChIKey | ASZMRCGOWFMPCF-GSDHBNRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aeromonas hydrophila (ncbitaxon:644) | - | DOI (10.1021/ja00089a058) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amonabactin P 693 (CHEBI:203380) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-amino-6-[(2,3-dihydroxybenzoyl)amino]hexanoyl]amino]-6-[(2,3-dihydroxybenzoyl)amino]hexanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440160 | ChemSpider |