EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30Cl2N6O11 |
| Net Charge | 0 |
| Average Mass | 673.463 |
| Monoisotopic Mass | 672.13496 |
| SMILES | NC(=NCCC[C@@H](NC(=O)c1ccc(Cl)c(O)c1O)C(=O)N[C@H](CCCN(O)C=O)C(=O)O)NC(=O)c1ccc(Cl)c(O)c1O |
| InChI | InChI=1S/C26H30Cl2N6O11/c27-14-7-5-12(18(36)20(14)38)22(40)31-16(24(42)32-17(25(43)44)4-2-10-34(45)11-35)3-1-9-30-26(29)33-23(41)13-6-8-15(28)21(39)19(13)37/h5-8,11,16-17,36-39,45H,1-4,9-10H2,(H,31,40)(H,32,42)(H,43,44)(H3,29,30,33,41)/t16-,17-/m1/s1 |
| InChIKey | RNSXINHQKGRUDO-IAGOWNOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (25408968) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorocatechelin A (CHEBI:203358) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2R)-2-[[(2R)-5-[[amino-[(4-chloro-2,3-dihydroxybenzoyl)amino]methylidene]amino]-2-[(4-chloro-2,3-dihydroxybenzoyl)amino]pentanoyl]amino]-5-[ormyl(hydroxy)amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437000 | ChemSpider |