EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO5 |
| Net Charge | 0 |
| Average Mass | 183.119 |
| Monoisotopic Mass | 183.01677 |
| SMILES | O=C(O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChIKey | QRYSWXFQLFLJTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salegentibacterspecies T436 (ncbitaxon:1729720) | - | PubMed (17551208) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxy-3-nitrobenzoic acid (CHEBI:203320) is a nitrobenzoic acid (CHEBI:25553) |
| IUPAC Name |
|---|
| 4-hydroxy-3-nitrobenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 11538 | ChemSpider |