EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | Cc1c(O)cc(O)c2c1[C@H](C)[C@@H](C)OC2=O |
| InChI | InChI=1S/C12H14O4/c1-5-7(3)16-12(15)11-9(14)4-8(13)6(2)10(5)11/h4-5,7,13-14H,1-3H3/t5-,7-/m1/s1 |
| InChIKey | PPEPKULENIXILK-IYSWYEEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium odoratum (ncbitaxon:1167516) | - | PubMed (7349286) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Decarboxydihydrocitrinone (CHEBI:203279) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 23076343 | ChemSpider |