EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O7 |
| Net Charge | 0 |
| Average Mass | 568.751 |
| Monoisotopic Mass | 568.34000 |
| SMILES | CC1=C(C)[C@]2(C[C@@H](C)[C@H]3CC[C@@]4(C)C5=C(C[C@@H](O2)[C@]34C)[C@@]2(C)CC[C@@H](OC(=O)CC(=O)O)C(C)(C)[C@@H]2CC5)OC1=O |
| InChI | InChI=1S/C34H48O7/c1-18-17-34(20(3)19(2)29(38)41-34)40-26-15-23-22(32(7)14-11-21(18)33(26,32)8)9-10-24-30(4,5)25(12-13-31(23,24)6)39-28(37)16-27(35)36/h18,21,24-26H,9-17H2,1-8H3,(H,35,36)/t18-,21-,24+,25-,26-,31-,32+,33+,34+/m1/s1 |
| InChIKey | UGLZSMAJBRYYDK-KZUYJXEZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Niveoporofomesspeciesaguei (ncbitaxon:270280) | - | PubMed (16002106) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fomitopsin B (CHEBI:203262) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 3-[(1S,5R,7R,10S,13R,15S,17R,18R,21R)-1,3',4',6,6,10,17,21-octamethyl-5'-oxospiro[14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-ene-15,2'-uran]-7-yl]oxy-3-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436987 | ChemSpider |