EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O2 |
| Net Charge | 0 |
| Average Mass | 286.415 |
| Monoisotopic Mass | 286.19328 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | AEMFNILZOJDQLW-QAGGRKNESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Changes in the Metabolic Elimination Profile of Testosterone Following Exposure of the Crustacean Daphnia magna to TributyltinGerald A. LeBlanc and James B. McLachlanEcotoxicology and Environmental Safety 45, 296-303 (2000)) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androst-4-ene-3,17-dione (CHEBI:16422) has role Daphnia magna metabolite (CHEBI:83056) |
| androst-4-ene-3,17-dione (CHEBI:16422) has role androgen (CHEBI:50113) |
| androst-4-ene-3,17-dione (CHEBI:16422) has role human metabolite (CHEBI:77746) |
| androst-4-ene-3,17-dione (CHEBI:16422) has role mouse metabolite (CHEBI:75771) |
| androst-4-ene-3,17-dione (CHEBI:16422) is a 17-oxo steroid (CHEBI:19168) |
| androst-4-ene-3,17-dione (CHEBI:16422) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| androst-4-ene-3,17-dione (CHEBI:16422) is a androstanoid (CHEBI:50402) |
| Incoming Relation(s) |
| 15α-hydroxyandrost-4-ene-3,17-dione (CHEBI:232766) has functional parent androst-4-ene-3,17-dione (CHEBI:16422) |
| 1α-hydroxyandrost-4-ene-3,17-dione (CHEBI:133778) has functional parent androst-4-ene-3,17-dione (CHEBI:16422) |
| 3,17-dioxoandrost-4-en-19-al (CHEBI:799) has functional parent androst-4-ene-3,17-dione (CHEBI:16422) |
| 6β-hydroxyandrost-4-ene-3,17-dione (CHEBI:87571) has functional parent androst-4-ene-3,17-dione (CHEBI:16422) |
| 9α-hydroxyandrost-4-en-3,17-dione (CHEBI:85549) has functional parent androst-4-ene-3,17-dione (CHEBI:16422) |
| IUPAC Name |
|---|
| androst-4-ene-3,17-dione |
| Synonyms | Source |
|---|---|
| 4-Androstene-3,17-dione | KEGG COMPOUND |
| 4-ANDROSTENE-3-17-DIONE | PDBeChem |
| Androst-4-ene-3,17-dione | KEGG COMPOUND |
| Androst-4-ene-3,17-dione | KEGG COMPOUND |
| Androstenedione | KEGG COMPOUND |
| Δ4-androsten-3,17-dione | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| androst-4-ene-3,17-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 215 | DrugCentral |
| ANDROST4ENE | MetaCyc |
| Androstenedione | Wikipedia |
| ASD | PDBeChem |
| C00003644 | KNApSAcK |
| C00280 | KEGG COMPOUND |
| D00051 | KEGG DRUG |
| DB01536 | DrugBank |
| HMDB0000053 | HMDB |
| LMST02020007 | LIPID MAPS |
| Citations |
|---|