EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O6S |
| Net Charge | 0 |
| Average Mass | 309.344 |
| Monoisotopic Mass | 309.09946 |
| SMILES | CS(=N)(=O)CC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N3O6S/c1-20(12,19)5-4-7(10(17)18)13-8(14)3-2-6(11)9(15)16/h6-7,12H,2-5,11H2,1H3,(H,13,14)(H,15,16)(H,17,18)/t6-,7-,20?/m0/s1 |
| InChIKey | NPPALQSPDYMHBI-ICZSOJPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.3209/saj.12_89) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-glutamylmethionine sulfoximine (CHEBI:203171) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(1S)-1-carboxy-3-(methylsulonimidoyl)propyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436969 | ChemSpider |