EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H40N2O7 |
| Net Charge | 0 |
| Average Mass | 444.569 |
| Monoisotopic Mass | 444.28355 |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)[C@H](OC(=O)[C@@H](C(C)C)N(C)C(=O)[C@H](O)C(C)C)C(C)C |
| InChI | InChI=1S/C22H40N2O7/c1-11(2)15(21(28)29)23(9)20(27)18(14(7)8)31-22(30)16(12(3)4)24(10)19(26)17(25)13(5)6/h11-18,25H,1-10H3,(H,28,29)/t15-,16+,17+,18+/m0/s1 |
| InChIKey | DNNNUEHTBMXDJS-BSDSXHPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium tricinctum (ncbitaxon:61284) | - | DOI (10.1016/j.tetlet.2013.03.005) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Subenniatin A (CHEBI:203168) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[(2R)-2-[[(2R)-2-hydroxy-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]oxy-3-methylbutanoyl]-methylamino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436968 | ChemSpider |