EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H16O5 |
| Net Charge | 0 |
| Average Mass | 408.409 |
| Monoisotopic Mass | 408.09977 |
| SMILES | O=C1C(=O)C(c2ccccc2)=c2c(-c3ccc(O)cc3)c(O)oc2=C1c1ccccc1 |
| InChI | InChI=1S/C26H16O5/c27-18-13-11-17(12-14-18)20-22-19(15-7-3-1-4-8-15)23(28)24(29)21(25(22)31-26(20)30)16-9-5-2-6-10-16/h1-14,27,30H |
| InChIKey | VFDVKMUPNVSMOG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peniophora (ncbitaxon:40463) | - | PubMed (6013455) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylerythrin (CHEBI:203160) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(4-hydroxyphenyl)-4,7-diphenyl-1-benzouran-5,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 78434754 | ChemSpider |