EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O5 |
| Net Charge | 0 |
| Average Mass | 324.332 |
| Monoisotopic Mass | 324.09977 |
| SMILES | C[C@]1(O)CC(=O)C2=C(CC(=O)c3c2cc2cccc(O)c2c3O)C1 |
| InChI | InChI=1S/C19H16O5/c1-19(24)7-10-6-13(21)17-11(15(10)14(22)8-19)5-9-3-2-4-12(20)16(9)18(17)23/h2-5,20,23-24H,6-8H2,1H3/t19-/m1/s1 |
| InChIKey | MJAYJPZTXHZTLP-LJQANCHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | - | PubMed (18988223) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,7,8-trihydroxy-3-methyl-4,5-dihydro-2H-benzo[a]anthracene-1,6-dione (CHEBI:203149) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (3R)-3,7,8-trihydroxy-3-methyl-4,5-dihydro-2H-benzo[a]anthracene-1,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 59702570 | ChemSpider |