EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N4O4 |
| Net Charge | 0 |
| Average Mass | 458.518 |
| Monoisotopic Mass | 458.19541 |
| SMILES | CC(=O)N(C)[C@H]1Cc2cn(c3ccccc23)C(=O)c2ccccc2NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C26H26N4O4/c1-16(31)28(2)23-14-17-15-30(21-11-6-4-8-18(17)21)25(33)19-9-3-5-10-20(19)27-24(32)22-12-7-13-29(22)26(23)34/h3-6,8-11,15,22-23H,7,12-14H2,1-2H3,(H,27,32)/t22-,23-/m0/s1 |
| InChIKey | VSOGHCWPRMMCAA-GOTSBHOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25246036) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Psychrophilin F (CHEBI:203123) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-methyl-N-[(11S,17S)-2,10,16-trioxo-1,9,15-triazapentacyclo[17.6.1.03,8.011,15.020,25]hexacosa-3,5,7,19(26),20,22,24-heptaen-17-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 34981334 | ChemSpider |