EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48O5 |
| Net Charge | 0 |
| Average Mass | 524.742 |
| Monoisotopic Mass | 524.35017 |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3=C(CCC2C1(C)C)[C@]1(C)C[C@H]2OC4(C[C@@H](C)[C@@H]2[C@@]1(C)CC3)OC(=O)C(C)=C4C |
| InChI | InChI=1S/C33H48O5/c1-18-16-33(20(3)19(2)28(35)38-33)37-24-17-32(9)23-10-11-25-29(5,6)26(36-21(4)34)13-14-30(25,7)22(23)12-15-31(32,8)27(18)24/h18,24-27H,10-17H2,1-9H3/t18-,24-,25?,26-,27+,30-,31-,32+,33?/m1/s1 |
| InChIKey | PBVCPPSYMGHWMG-KFKYFVHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hexagonia apiaria (ncbitaxon:252826) | - | PubMed (26575215) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hexagonin C (CHEBI:203115) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(2R,4R,8R,9R,10R,14S,17R)-2,3',4',8,10,14,18,18-octamethyl-5'-oxospiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-1(13)-ene-6,2'-uran]-17-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 78440930 | ChemSpider |