EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O5 |
| Net Charge | 0 |
| Average Mass | 240.255 |
| Monoisotopic Mass | 240.09977 |
| SMILES | COC(=O)[C@@]12C(O)[C@@]3(C)O[C@@H]1[C@@H](C=C[C@@H]2C)O3 |
| InChI | InChI=1S/C12H16O5/c1-6-4-5-7-8-12(6,10(14)15-3)9(13)11(2,16-7)17-8/h4-9,13H,1-3H3/t6-,7+,8+,9?,11+,12+/m0/s1 |
| InChIKey | CMKNRAGJXTXODZ-YRMMBSSSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pleotrichocladium opacum (ncbitaxon:2016671) | - | DOI (10.1002/ejoc.200900735) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichocladinol B (CHEBI:203108) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| methyl (1R,3R,6S,7S,8S)-10-hydroxy-1,6-dimethyl-2,9-dioxatricyclo[5.2.1.03,8]dec-4-ene-7-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78436959 | ChemSpider |