EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO8 |
| Net Charge | 0 |
| Average Mass | 419.430 |
| Monoisotopic Mass | 419.15802 |
| SMILES | C/C=C/CCC(=O)C1=C(O)C(C)=C(O)[C@@]2(C)OC(=O)[C@@](C)(NC(=O)/C=C/C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C21H25NO8/c1-5-6-7-8-12(23)15-16(27)11(2)18(28)21(4)17(15)20(3,19(29)30-21)22-13(24)9-10-14(25)26/h5-6,9-10,17,27-28H,7-8H2,1-4H3,(H,22,24)(H,25,26)/b6-5+,10-9+/t17-,20+,21+/m1/s1 |
| InChIKey | FBHQVVAZJLEQBG-NVZCPQDISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | - | DOI (10.1016/j.tet.2005.05.026) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sorbicillactone B (CHEBI:203077) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (E)-4-[[(3S,3aR,7aS)-4-[(E)-hex-4-enoyl]-5,7-dihydroxy-3,6,7a-trimethyl-2-oxo-3aH-1-benzouran-3-yl]amino]-4-oxobut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9593585 | ChemSpider |