EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O3 |
| Net Charge | 0 |
| Average Mass | 183.167 |
| Monoisotopic Mass | 183.06439 |
| SMILES | Cc1c(NO)cc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9N3O3/c1-4-6(9-11)2-5(8)3-7(4)10(12)13/h2-3,9,11H,8H2,1H3 |
| InChIKey | VQMWRUKXHJGSIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-2-hydroxylamino-6-nitrotoluene (CHEBI:20307) has role xenobiotic metabolite (CHEBI:76206) |
| 4-amino-2-hydroxylamino-6-nitrotoluene (CHEBI:20307) is a amino-nitrotoluene (CHEBI:22482) |
| 4-amino-2-hydroxylamino-6-nitrotoluene (CHEBI:20307) is a hydroxylamines (CHEBI:24709) |
| IUPAC Name |
|---|
| N3-hydroxy-4-methyl-5-nitrobenzene-1,3-diamine |
| UniProt Name | Source |
|---|---|
| 4-amino-2-hydroxylamino-6-nitrotoluene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8315305 | Reaxys |