EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H88O2 |
| Net Charge | 0 |
| Average Mass | 793.318 |
| Monoisotopic Mass | 792.67843 |
| SMILES | CC1=C(C/C=C(\C)CCCC(C)CCCC(C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCC(C)CCCC(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C56H88O2/c1-42(2)22-14-23-43(3)24-15-25-44(4)26-16-27-45(5)28-17-29-46(6)30-18-31-47(7)32-19-33-48(8)34-20-35-49(9)36-21-37-50(10)40-41-52-51(11)55(57)53-38-12-13-39-54(53)56(52)58/h12-13,26,28,30,32,38-40,42-43,48-49H,14-25,27,29,31,33-37,41H2,1-11H3/b44-26+,45-28+,46-30+,47-32+,50-40+ |
| InChIKey | DBEAKYNIPYLYDO-VFACPGNZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Natronobacterium gregoryi (ncbitaxon:44930) | - | DOI (10.1016/0378-1097(87)90417-4) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Octahydromenaquinone MK-9(II,III,VIII,IX) (CHEBI:203045) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| 2-methyl-3-[(2E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,14,18,22,26-pentaenyl]naphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78444977 | ChemSpider |