EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O5S |
| Net Charge | 0 |
| Average Mass | 357.432 |
| Monoisotopic Mass | 357.13584 |
| SMILES | CSCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CCC(=O)O)NC1=O |
| InChI | InChI=1S/C15H23N3O5S/c1-24-8-6-9-13(21)17-10(4-5-12(19)20)15(23)18-7-2-3-11(18)14(22)16-9/h9-11H,2-8H2,1H3,(H,16,22)(H,17,21)(H,19,20)/t9-,10-,11+/m0/s1 |
| InChIKey | BINXEQIRYMUAAD-GARJFASQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies RM-27-46 (ncbitaxon:1429102) | - | PubMed (24713874) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mullinamide B (CHEBI:203006) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 3-[(3S,6S,11aR)-3-(2-methylsulanylethyl)-1,4,7-trioxo-2,3,5,6,9,10,11,11a-octahydropyrrolo[1,2-a][1,4,7]triazonin-6-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440148 | ChemSpider |