EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N4O6 |
| Net Charge | 0 |
| Average Mass | 490.516 |
| Monoisotopic Mass | 490.18523 |
| SMILES | CC(=O)N(C)[C@@H]1C(=O)N2CCC[C@H]2C(=O)Nc2ccccc2C(=O)n2cc(c3c(O)cccc32)[C@H]1O |
| InChI | InChI=1S/C26H26N4O6/c1-14(31)28(2)22-23(33)16-13-30(18-9-5-11-20(32)21(16)18)25(35)15-7-3-4-8-17(15)27-24(34)19-10-6-12-29(19)26(22)36/h3-5,7-9,11,13,19,22-23,32-33H,6,10,12H2,1-2H3,(H,27,34)/t19-,22-,23+/m0/s1 |
| InChIKey | WOGFDKAZQFMVBX-AJSBUHFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25246036) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Psychrophilin H (CHEBI:202989) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[(11S,17S,18R)-18,21-dihydroxy-2,10,16-trioxo-1,9,15-triazapentacyclo[17.6.1.03,8.011,15.020,25]hexacosa-3,5,7,19(26),20(25),21,23-heptaen-17-yl]-N-methylacetamide |
| Manual Xrefs | Databases |
|---|---|
| 34981336 | ChemSpider |