EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O13 |
| Net Charge | 0 |
| Average Mass | 642.739 |
| Monoisotopic Mass | 642.32514 |
| SMILES | C=C[C@]1(C)C=C2C=C[C@@H]3[C@](C)(C[C@@H](O)[C@H](O)[C@]3(C)CO[C@@H]3O[C@H](CO[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@@H](O)[C@@H]3O)[C@H]2CC1 |
| InChI | InChI=1S/C32H50O13/c1-5-30(2)9-8-16-15(10-30)6-7-20-31(16,3)11-17(34)27(41)32(20,4)14-43-29-26(40)24(38)22(36)19(45-29)13-42-28-25(39)23(37)21(35)18(12-33)44-28/h5-7,10,16-29,33-41H,1,8-9,11-14H2,2-4H3/t16-,17+,18+,19+,20+,21+,22+,23-,24+,25+,26-,27-,28-,29+,30-,31+,32+/m0/s1 |
| InChIKey | IAJMJDCUKLCZIS-UQFPQHCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremonium (ncbitaxon:159075) | - | DOI (10.1016/j.phytol.2015.11.010) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Virescenoside R1 (CHEBI:202978) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (2S,3R,4S,5S,6R)-2-[[(2R,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,4bR,7R,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Manual Xrefs | Databases |
|---|---|
| 78440147 | ChemSpider |