EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | CCC[C@@H]1Cc2c(O)ccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C12H14O4/c1-2-3-7-6-8-9(13)4-5-10(14)11(8)12(15)16-7/h4-5,7,13-14H,2-3,6H2,1H3/t7-/m1/s1 |
| InChIKey | QCSZJTQLDKTFCT-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | DOI (10.1002/ejoc.200801052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomolactone B (CHEBI:202916) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-5,8-dihydroxy-3-propyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78436931 | ChemSpider |