EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N7O7 |
| Net Charge | 0 |
| Average Mass | 571.635 |
| Monoisotopic Mass | 571.27545 |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)C2C(O)C(O)CNN2C(=O)[C@@H](Cc2cncn2)NC1=O |
| InChI | InChI=1S/C27H37N7O7/c1-4-14(2)21-25(38)32-19(10-16-11-28-13-29-16)27(40)34-22(23(36)20(35)12-30-34)26(39)31-18(24(37)33-21)9-15-5-7-17(41-3)8-6-15/h5-8,11,13-14,18-23,30,35-36H,4,9-10,12H2,1-3H3,(H,28,29)(H,31,39)(H,32,38)(H,33,37)/t14-,18+,19-,20?,21-,22?,23?/m1/s1 |
| InChIKey | NNIBMMQVFDWAAF-ABHIBMEJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendulae (ncbitaxon:1914) | - | PubMed (12670047) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glomecidin (CHEBI:202894) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| (3R,6R,9S)-6-[(2R)-butan-2-yl]-13,14-dihydroxy-3-(1H-imidazol-5-ylmethyl)-9-[(4-methoxyphenyl)methyl]-1,4,7,10,16-pentazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 9321332 | ChemSpider |