EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O3 |
| Net Charge | 0 |
| Average Mass | 258.277 |
| Monoisotopic Mass | 258.10044 |
| SMILES | CO[C@@]1(C)C(=O)n2c(cc3ccccc32)C(=O)N1C |
| InChI | InChI=1S/C14H14N2O3/c1-14(19-3)13(18)16-10-7-5-4-6-9(10)8-11(16)12(17)15(14)2/h4-8H,1-3H3/t14-/m0/s1 |
| InChIKey | KYICCVZKMGLROE-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus thermomutatus (ncbitaxon:41047) | - | PubMed (25421322) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neosartin A (CHEBI:202875) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 3-methoxy-2,3-dimethylpyrazino[1,2-a]indole-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 34981182 | ChemSpider |