EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18O6 |
| Net Charge | 0 |
| Average Mass | 414.413 |
| Monoisotopic Mass | 414.11034 |
| SMILES | CC(O)=c1ccc2c(c1O)c(=O)c1c3cc(C)cc(=O)c3c(O)c3c(O)cc(C)c2c31 |
| InChI | InChI=1S/C25H18O6/c1-9-6-14-18(15(27)7-9)24(30)21-16(28)8-10(2)17-13-5-4-12(11(3)26)23(29)20(13)25(31)19(14)22(17)21/h4-8,26,28-30H,1-3H3 |
| InChIKey | HKZBCPLWGPITMW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clostridium beijerinckii (ncbitaxon:1520) | - | PubMed (24827417) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clostrubin A (CHEBI:202872) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 8,10,18-trihydroxy-17-(1-hydroxyethylidene)-4,12-dimethylpentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,7,9,11,13,15,18-nonaene-6,20-dione |
| Manual Xrefs | Databases |
|---|---|
| 78434736 | ChemSpider |