EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O2S |
| Net Charge | 0 |
| Average Mass | 118.157 |
| Monoisotopic Mass | 118.00885 |
| SMILES | CS/C=C/C(=O)O |
| InChI | InChI=1S/C4H6O2S/c1-7-3-2-4(5)6/h2-3H,1H3,(H,5,6)/b3-2+ |
| InChIKey | RCZLOQQOUWHMIS-NSCUHMNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lincolnensis (ncbitaxon:1915) | - | PubMed (5350511) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trans-3-Methylthioacrylic acid (CHEBI:202851) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| (E)-3-methylsulanylprop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4945633 | ChemSpider |