EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO6 |
| Net Charge | 0 |
| Average Mass | 323.345 |
| Monoisotopic Mass | 323.13689 |
| SMILES | CCCC(=O)c1c(C)cc(C(=O)N[C@@H](CO)C(=O)O)cc1OC |
| InChI | InChI=1S/C16H21NO6/c1-4-5-12(19)14-9(2)6-10(7-13(14)23-3)15(20)17-11(8-18)16(21)22/h6-7,11,18H,4-5,8H2,1-3H3,(H,17,20)(H,21,22)/t11-/m0/s1 |
| InChIKey | UERRLUZGPOHSRG-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scopulariopsisspecies (ncbitaxon:2006378) | - | DOI (10.1016/j.tet.2016.03.073) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scopulamide (CHEBI:202841) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-2-[(4-butanoyl-3-methoxy-5-methylbenzoyl)amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196697 | ChemSpider |