EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27ClO4 |
| Net Charge | 0 |
| Average Mass | 342.863 |
| Monoisotopic Mass | 342.15979 |
| SMILES | C[C@H]1[C@H](O)[C@@H](Cl)[C@H]2C[C@](C)(O)C[C@@H](C)[C@@H]2[C@H]1/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C18H27ClO4/c1-10-8-18(3,23)9-13-15(10)12(6-4-5-7-14(20)21)11(2)17(22)16(13)19/h4-7,10-13,15-17,22-23H,8-9H2,1-3H3,(H,20,21)/b6-4+,7-5+/t10-,11-,12+,13+,15-,16+,17+,18-/m1/s1 |
| InChIKey | LQERRSZNVUJFFC-GKRHHQKTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (26055397) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid P (CHEBI:202801) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1R,2R,3S,4S,4aS,6R,8R,8aR)-4-chloro-3,6-dihydroxy-2,6,8-trimethyl-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-1-yl]penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35517052 | ChemSpider |