EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N4O5 |
| Net Charge | 0 |
| Average Mass | 510.635 |
| Monoisotopic Mass | 510.28422 |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](C(=O)Nc1ccccc1C(=O)O)C(C)C |
| InChI | InChI=1S/C28H38N4O5/c1-6-18(4)23(29)27(35)32(5)22(16-19-12-8-7-9-13-19)25(33)31-24(17(2)3)26(34)30-21-15-11-10-14-20(21)28(36)37/h7-15,17-18,22-24H,6,16,29H2,1-5H3,(H,30,34)(H,31,33)(H,36,37)/t18-,22-,23+,24+/m1/s1 |
| InChIKey | XTDZXTPSBXVWFR-LKDDOFHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simplicillium (ncbitaxon:292631) | - | DOI (10.1016/j.tet.2016.04.032) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simplicilliumtide B (CHEBI:202735) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-[[(2R)-2-[[(2S,3R)-2-amino-3-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196797 | ChemSpider |