EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O5 |
| Net Charge | 0 |
| Average Mass | 388.464 |
| Monoisotopic Mass | 388.19982 |
| SMILES | CC(/C=C/C(=O)NC(C)(CO)C(=O)O)=C\[C@@H](C)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O5/c1-14(6-11-18(25)22-21(3,13-24)20(27)28)12-15(2)19(26)16-7-9-17(10-8-16)23(4)5/h6-12,15,24H,13H2,1-5H3,(H,22,25)(H,27,28)/b11-6+,14-12+/t15-,21?/m1/s1 |
| InChIKey | VTYVYDJWZOWXEE-CQETWIIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (22276693) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-111 (CHEBI:202727) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(2E,4E,6R)-7-[4-(dimethylamino)phenyl]-4,6-dimethyl-7-oxohepta-2,4-dienoyl]amino]-3-hydroxy-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441896 | ChemSpider |